C13H26N2O — CID 120844252
2-(3-methoxy-2,2-dimethylpropyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-amine (PubChem CID 120844252) has the molecular formula C13H26N2O and a molecular weight of 226.36 g/mol. Its IUPAC name is 2-(3-methoxy-2,2-dimethylpropyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-amine.
| Compound Name | 2-(3-methoxy-2,2-dimethylpropyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-amine |
|---|---|
| PubChem CID | 120844252 |
| Molecular Formula | C13H26N2O |
| Molecular Weight | 226.36 g/mol |
| Exact Mass | 226.20 |
| IUPAC Name | 2-(3-methoxy-2,2-dimethylpropyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-amine |
| SMILES | COCC(C)(C)CN1CC2CCC(N)C2C1 |
| InChI | InChI=1S/C13H26N2O/c1-13(2,9-16-3)8-15-6-10-4-5-12(14)11(10)7-15/h10-12H,4-9,14H2,1-3H3 |
| InChIKey | OSVPZATYNBMPKC-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.36 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |