C14H22ClN5O — CID 120844531
1-[1-[(4-chloro-1-methylpyrazol-5-yl)methyl]piperidin-3-yl]piperazin-2-one (PubChem CID 120844531) has the molecular formula C14H22ClN5O and a molecular weight of 311.82 g/mol. Its IUPAC name is 1-[1-[(4-chloro-1-methylpyrazol-5-yl)methyl]piperidin-3-yl]piperazin-2-one.
| Compound Name | 1-[1-[(4-chloro-1-methylpyrazol-5-yl)methyl]piperidin-3-yl]piperazin-2-one |
|---|---|
| PubChem CID | 120844531 |
| Molecular Formula | C14H22ClN5O |
| Molecular Weight | 311.82 g/mol |
| Exact Mass | 311.15 |
| IUPAC Name | 1-[1-[(4-chloro-1-methylpyrazol-5-yl)methyl]piperidin-3-yl]piperazin-2-one |
| SMILES | Cn1ncc(Cl)c1CN1CCCC(N2CCNCC2=O)C1 |
| InChI | InChI=1S/C14H22ClN5O/c1-18-13(12(15)7-17-18)10-19-5-2-3-11(9-19)20-6-4-16-8-14(20)21/h7,11,16H,2-6,8-10H2,1H3 |
| InChIKey | OSTSTCXMUXUJKG-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 53.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.82 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |