About (2R,6S)-1-[(4-chlorothiophen-2-yl)methyl]-2,6-dimethylpiperazine;hydrochloride
(2R,6S)-1-[(4-chlorothiophen-2-yl)methyl]-2,6-dimethylpiperazine;hydrochloride (PubChem CID 120844690) has the molecular formula C11H18Cl2N2S
and a molecular weight of 281.25 g/mol. Its IUPAC name is (2R,6S)-1-[(4-chlorothiophen-2-yl)methyl]-2,6-dimethylpiperazine;hydrochloride.
Molecular Properties
| Compound Name | (2R,6S)-1-[(4-chlorothiophen-2-yl)methyl]-2,6-dimethylpiperazine;hydrochloride |
| PubChem CID | 120844690 |
| Molecular Formula | C11H18Cl2N2S |
| Molecular Weight | 281.25 g/mol |
| Exact Mass | 280.06 |
| IUPAC Name | (2R,6S)-1-[(4-chlorothiophen-2-yl)methyl]-2,6-dimethylpiperazine;hydrochloride |
| SMILES | C[C@@H]1CNC[C@H](C)N1Cc1cc(Cl)cs1.Cl |
| InChI | InChI=1S/C11H17ClN2S.ClH/c1-8-4-13-5-9(2)14(8)6-11-3-10(12)7-15-11;/h3,7-9,13H,4-6H2,1-2H3;1H/t8-,9+; |
| InChIKey | DKFOQXVZYKKGQQ-UFIFRZAQSA-N |
| XLogP | 3.01 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.25 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2R,6S)-1-[(4-chlorothiophen-2-yl)methyl]-2,6-dimethylpiperazine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,6S)-1-[(4-chlorothiophen-2-yl)methyl]-2,6-dimethylpiperazine;hydrochloride?
The IUPAC name of (2R,6S)-1-[(4-chlorothiophen-2-yl)methyl]-2,6-dimethylpiperazine;hydrochloride (CID 120844690) is (2R,6S)-1-[(4-chlorothiophen-2-yl)methyl]-2,6-dimethylpiperazine;hydrochloride.
What is the SMILES notation for (2R,6S)-1-[(4-chlorothiophen-2-yl)methyl]-2,6-dimethylpiperazine;hydrochloride?
The canonical SMILES for (2R,6S)-1-[(4-chlorothiophen-2-yl)methyl]-2,6-dimethylpiperazine;hydrochloride is C[C@@H]1CNC[C@H](C)N1Cc1cc(Cl)cs1.Cl.
What is the InChIKey of (2R,6S)-1-[(4-chlorothiophen-2-yl)methyl]-2,6-dimethylpiperazine;hydrochloride?
The InChIKey is DKFOQXVZYKKGQQ-UFIFRZAQSA-N. The full InChI is InChI=1S/C11H17ClN2S.ClH/c1-8-4-13-5-9(2)14(8)6-11-3-10(12)7-15-11;/h3,7-9,13H,4-6H2,1-2H3;1H/t8-,9+;.
What are the key properties of (2R,6S)-1-[(4-chlorothiophen-2-yl)methyl]-2,6-dimethylpiperazine;hydrochloride?
(2R,6S)-1-[(4-chlorothiophen-2-yl)methyl]-2,6-dimethylpiperazine;hydrochloride has a molecular weight of 281.25 g/mol, XLogP of 3.01, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,6S)-1-[(4-chlorothiophen-2-yl)methyl]-2,6-dimethylpiperazine;hydrochloride is sourced from PubChem (CID 120844690), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).