C19H23Cl2FN4 — CID 120845220
N-[(2,3-dichloro-4-fluorophenyl)methyl]-N-[(1-methylimidazol-2-yl)methyl]-6-azaspiro[2.5]octan-2-amine (PubChem CID 120845220) has the molecular formula C19H23Cl2FN4 and a molecular weight of 397.33 g/mol. Its IUPAC name is N-[(2,3-dichloro-4-fluorophenyl)methyl]-N-[(1-methylimidazol-2-yl)methyl]-6-azaspiro[2.5]octan-2-amine.
| Compound Name | N-[(2,3-dichloro-4-fluorophenyl)methyl]-N-[(1-methylimidazol-2-yl)methyl]-6-azaspiro[2.5]octan-2-amine |
|---|---|
| PubChem CID | 120845220 |
| Molecular Formula | C19H23Cl2FN4 |
| Molecular Weight | 397.33 g/mol |
| Exact Mass | 396.13 |
| IUPAC Name | N-[(2,3-dichloro-4-fluorophenyl)methyl]-N-[(1-methylimidazol-2-yl)methyl]-6-azaspiro[2.5]octan-2-amine |
| SMILES | Cn1ccnc1CN(Cc1ccc(F)c(Cl)c1Cl)C1CC12CCNCC2 |
| InChI | InChI=1S/C19H23Cl2FN4/c1-25-9-8-24-16(25)12-26(15-10-19(15)4-6-23-7-5-19)11-13-2-3-14(22)18(21)17(13)20/h2-3,8-9,15,23H,4-7,10-12H2,1H3 |
| InChIKey | LITTUTYYKZTQMW-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.33 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|