About (3S)-1-[(4,5-dichlorothiophen-3-yl)methyl]-3-methylpiperazine;hydrochloride
(3S)-1-[(4,5-dichlorothiophen-3-yl)methyl]-3-methylpiperazine;hydrochloride (PubChem CID 120845881) has the molecular formula C10H15Cl3N2S
and a molecular weight of 301.67 g/mol. Its IUPAC name is (3S)-1-[(4,5-dichlorothiophen-3-yl)methyl]-3-methylpiperazine;hydrochloride.
Molecular Properties
| Compound Name | (3S)-1-[(4,5-dichlorothiophen-3-yl)methyl]-3-methylpiperazine;hydrochloride |
| PubChem CID | 120845881 |
| Molecular Formula | C10H15Cl3N2S |
| Molecular Weight | 301.67 g/mol |
| Exact Mass | 300.00 |
| IUPAC Name | (3S)-1-[(4,5-dichlorothiophen-3-yl)methyl]-3-methylpiperazine;hydrochloride |
| SMILES | C[C@H]1CN(Cc2csc(Cl)c2Cl)CCN1.Cl |
| InChI | InChI=1S/C10H14Cl2N2S.ClH/c1-7-4-14(3-2-13-7)5-8-6-15-10(12)9(8)11;/h6-7,13H,2-5H2,1H3;1H/t7-;/m0./s1 |
| InChIKey | HSJZVGKUBJTDIN-FJXQXJEOSA-N |
| XLogP | 3.27 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.67 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3S)-1-[(4,5-dichlorothiophen-3-yl)methyl]-3-methylpiperazine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-1-[(4,5-dichlorothiophen-3-yl)methyl]-3-methylpiperazine;hydrochloride?
The IUPAC name of (3S)-1-[(4,5-dichlorothiophen-3-yl)methyl]-3-methylpiperazine;hydrochloride (CID 120845881) is (3S)-1-[(4,5-dichlorothiophen-3-yl)methyl]-3-methylpiperazine;hydrochloride.
What is the SMILES notation for (3S)-1-[(4,5-dichlorothiophen-3-yl)methyl]-3-methylpiperazine;hydrochloride?
The canonical SMILES for (3S)-1-[(4,5-dichlorothiophen-3-yl)methyl]-3-methylpiperazine;hydrochloride is C[C@H]1CN(Cc2csc(Cl)c2Cl)CCN1.Cl.
What is the InChIKey of (3S)-1-[(4,5-dichlorothiophen-3-yl)methyl]-3-methylpiperazine;hydrochloride?
The InChIKey is HSJZVGKUBJTDIN-FJXQXJEOSA-N. The full InChI is InChI=1S/C10H14Cl2N2S.ClH/c1-7-4-14(3-2-13-7)5-8-6-15-10(12)9(8)11;/h6-7,13H,2-5H2,1H3;1H/t7-;/m0./s1.
What are the key properties of (3S)-1-[(4,5-dichlorothiophen-3-yl)methyl]-3-methylpiperazine;hydrochloride?
(3S)-1-[(4,5-dichlorothiophen-3-yl)methyl]-3-methylpiperazine;hydrochloride has a molecular weight of 301.67 g/mol, XLogP of 3.27, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-1-[(4,5-dichlorothiophen-3-yl)methyl]-3-methylpiperazine;hydrochloride is sourced from PubChem (CID 120845881), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).