C17H30ClN3O2S — CID 120847370
2-methyl-1-[4-(4-propan-2-ylphenyl)sulfonylpiperazin-1-yl]propan-2-amine;hydrochloride (PubChem CID 120847370) has the molecular formula C17H30ClN3O2S and a molecular weight of 375.97 g/mol. Its IUPAC name is 2-methyl-1-[4-(4-propan-2-ylphenyl)sulfonylpiperazin-1-yl]propan-2-amine;hydrochloride.
| Compound Name | 2-methyl-1-[4-(4-propan-2-ylphenyl)sulfonylpiperazin-1-yl]propan-2-amine;hydrochloride |
|---|---|
| PubChem CID | 120847370 |
| Molecular Formula | C17H30ClN3O2S |
| Molecular Weight | 375.97 g/mol |
| Exact Mass | 375.17 |
| IUPAC Name | 2-methyl-1-[4-(4-propan-2-ylphenyl)sulfonylpiperazin-1-yl]propan-2-amine;hydrochloride |
| SMILES | CC(C)c1ccc(S(=O)(=O)N2CCN(CC(C)(C)N)CC2)cc1.Cl |
| InChI | InChI=1S/C17H29N3O2S.ClH/c1-14(2)15-5-7-16(8-6-15)23(21,22)20-11-9-19(10-12-20)13-17(3,4)18;/h5-8,14H,9-13,18H2,1-4H3;1H |
| InChIKey | IVUIYLSKJULSBE-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.97 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |