C13H26ClN3O — CID 120848758
8-(piperidin-3-ylmethyl)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazine;hydrochloride (PubChem CID 120848758) has the molecular formula C13H26ClN3O and a molecular weight of 275.82 g/mol. Its IUPAC name is 8-(piperidin-3-ylmethyl)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazine;hydrochloride.
| Compound Name | 8-(piperidin-3-ylmethyl)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazine;hydrochloride |
|---|---|
| PubChem CID | 120848758 |
| Molecular Formula | C13H26ClN3O |
| Molecular Weight | 275.82 g/mol |
| Exact Mass | 275.18 |
| IUPAC Name | 8-(piperidin-3-ylmethyl)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazine;hydrochloride |
| SMILES | C1CNCC(CN2CCN3CCOCC3C2)C1.Cl |
| InChI | InChI=1S/C13H25N3O.ClH/c1-2-12(8-14-3-1)9-15-4-5-16-6-7-17-11-13(16)10-15;/h12-14H,1-11H2;1H |
| InChIKey | RGMBLCLCGBZWNK-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.82 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |