C18H22N2S — CID 120849432
7-[(4-thiophen-3-ylpiperidin-1-yl)methyl]-2,3-dihydro-1H-indole (PubChem CID 120849432) has the molecular formula C18H22N2S and a molecular weight of 298.45 g/mol. Its IUPAC name is 7-[(4-thiophen-3-ylpiperidin-1-yl)methyl]-2,3-dihydro-1H-indole.
| Compound Name | 7-[(4-thiophen-3-ylpiperidin-1-yl)methyl]-2,3-dihydro-1H-indole |
|---|---|
| PubChem CID | 120849432 |
| Molecular Formula | C18H22N2S |
| Molecular Weight | 298.45 g/mol |
| Exact Mass | 298.15 |
| IUPAC Name | 7-[(4-thiophen-3-ylpiperidin-1-yl)methyl]-2,3-dihydro-1H-indole |
| SMILES | c1cc2c(c(CN3CCC(c4ccsc4)CC3)c1)NCC2 |
| InChI | InChI=1S/C18H22N2S/c1-2-15-4-8-19-18(15)16(3-1)12-20-9-5-14(6-10-20)17-7-11-21-13-17/h1-3,7,11,13-14,19H,4-6,8-10,12H2 |
| InChIKey | GWXGDGDOKVJNDT-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.45 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |