C16H24FN3O — CID 120849820
3-fluoro-2-[1-(piperidin-3-ylmethyl)piperidin-4-yl]oxypyridine (PubChem CID 120849820) has the molecular formula C16H24FN3O and a molecular weight of 293.39 g/mol. Its IUPAC name is 3-fluoro-2-[1-(piperidin-3-ylmethyl)piperidin-4-yl]oxypyridine.
| Compound Name | 3-fluoro-2-[1-(piperidin-3-ylmethyl)piperidin-4-yl]oxypyridine |
|---|---|
| PubChem CID | 120849820 |
| Molecular Formula | C16H24FN3O |
| Molecular Weight | 293.39 g/mol |
| Exact Mass | 293.19 |
| IUPAC Name | 3-fluoro-2-[1-(piperidin-3-ylmethyl)piperidin-4-yl]oxypyridine |
| SMILES | Fc1cccnc1OC1CCN(CC2CCCNC2)CC1 |
| InChI | InChI=1S/C16H24FN3O/c17-15-4-2-8-19-16(15)21-14-5-9-20(10-6-14)12-13-3-1-7-18-11-13/h2,4,8,13-14,18H,1,3,5-7,9-12H2 |
| InChIKey | BXOXFTAWJSVNHJ-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.39 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |