C12H18BrClN2O — CID 120851632
N-[(2-bromo-5-methoxyphenyl)methyl]-N-methylazetidin-3-amine;hydrochloride (PubChem CID 120851632) has the molecular formula C12H18BrClN2O and a molecular weight of 321.65 g/mol. Its IUPAC name is N-[(2-bromo-5-methoxyphenyl)methyl]-N-methylazetidin-3-amine;hydrochloride.
| Compound Name | N-[(2-bromo-5-methoxyphenyl)methyl]-N-methylazetidin-3-amine;hydrochloride |
|---|---|
| PubChem CID | 120851632 |
| Molecular Formula | C12H18BrClN2O |
| Molecular Weight | 321.65 g/mol |
| Exact Mass | 320.03 |
| IUPAC Name | N-[(2-bromo-5-methoxyphenyl)methyl]-N-methylazetidin-3-amine;hydrochloride |
| SMILES | COc1ccc(Br)c(CN(C)C2CNC2)c1.Cl |
| InChI | InChI=1S/C12H17BrN2O.ClH/c1-15(10-6-14-7-10)8-9-5-11(16-2)3-4-12(9)13;/h3-5,10,14H,6-8H2,1-2H3;1H |
| InChIKey | BVMQWZCTIQHGSJ-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.65 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |