C19H24ClN5O3 — CID 120852559
1-[5-[4-(2-methoxyethoxy)-1-phenylpyrazol-3-yl]-1,2,4-oxadiazol-3-yl]cyclopentan-1-amine;hydrochloride (PubChem CID 120852559) has the molecular formula C19H24ClN5O3 and a molecular weight of 405.89 g/mol. Its IUPAC name is 1-[5-[4-(2-methoxyethoxy)-1-phenylpyrazol-3-yl]-1,2,4-oxadiazol-3-yl]cyclopentan-1-amine;hydrochloride.
| Compound Name | 1-[5-[4-(2-methoxyethoxy)-1-phenylpyrazol-3-yl]-1,2,4-oxadiazol-3-yl]cyclopentan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 120852559 |
| Molecular Formula | C19H24ClN5O3 |
| Molecular Weight | 405.89 g/mol |
| Exact Mass | 405.16 |
| IUPAC Name | 1-[5-[4-(2-methoxyethoxy)-1-phenylpyrazol-3-yl]-1,2,4-oxadiazol-3-yl]cyclopentan-1-amine;hydrochloride |
| SMILES | COCCOc1cn(-c2ccccc2)nc1-c1nc(C2(N)CCCC2)no1.Cl |
| InChI | InChI=1S/C19H23N5O3.ClH/c1-25-11-12-26-15-13-24(14-7-3-2-4-8-14)22-16(15)17-21-18(23-27-17)19(20)9-5-6-10-19;/h2-4,7-8,13H,5-6,9-12,20H2,1H3;1H |
| InChIKey | GOGWCOBXVWPCSN-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 101.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.89 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|