C11H13ClIN3OS — CID 120855437
1-[5-(5-iodothiophen-3-yl)-1,2,4-oxadiazol-3-yl]cyclopentan-1-amine;hydrochloride (PubChem CID 120855437) has the molecular formula C11H13ClIN3OS and a molecular weight of 397.67 g/mol. Its IUPAC name is 1-[5-(5-iodothiophen-3-yl)-1,2,4-oxadiazol-3-yl]cyclopentan-1-amine;hydrochloride.
| Compound Name | 1-[5-(5-iodothiophen-3-yl)-1,2,4-oxadiazol-3-yl]cyclopentan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 120855437 |
| Molecular Formula | C11H13ClIN3OS |
| Molecular Weight | 397.67 g/mol |
| Exact Mass | 396.95 |
| IUPAC Name | 1-[5-(5-iodothiophen-3-yl)-1,2,4-oxadiazol-3-yl]cyclopentan-1-amine;hydrochloride |
| SMILES | Cl.NC1(c2noc(-c3csc(I)c3)n2)CCCC1 |
| InChI | InChI=1S/C11H12IN3OS.ClH/c12-8-5-7(6-17-8)9-14-10(15-16-9)11(13)3-1-2-4-11;/h5-6H,1-4,13H2;1H |
| InChIKey | LAPROKAFWKZHNA-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.67 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|