C20H21N5O2 — CID 120856143
1-[4-[3-(1-aminocyclopentyl)-1,2,4-oxadiazol-5-yl]phenyl]-3-phenylurea (PubChem CID 120856143) has the molecular formula C20H21N5O2 and a molecular weight of 363.42 g/mol. Its IUPAC name is 1-[4-[3-(1-aminocyclopentyl)-1,2,4-oxadiazol-5-yl]phenyl]-3-phenylurea.
| Compound Name | 1-[4-[3-(1-aminocyclopentyl)-1,2,4-oxadiazol-5-yl]phenyl]-3-phenylurea |
|---|---|
| PubChem CID | 120856143 |
| Molecular Formula | C20H21N5O2 |
| Molecular Weight | 363.42 g/mol |
| Exact Mass | 363.17 |
| IUPAC Name | 1-[4-[3-(1-aminocyclopentyl)-1,2,4-oxadiazol-5-yl]phenyl]-3-phenylurea |
| SMILES | NC1(c2noc(-c3ccc(NC(=O)Nc4ccccc4)cc3)n2)CCCC1 |
| InChI | InChI=1S/C20H21N5O2/c21-20(12-4-5-13-20)18-24-17(27-25-18)14-8-10-16(11-9-14)23-19(26)22-15-6-2-1-3-7-15/h1-3,6-11H,4-5,12-13,21H2,(H2,22,23,26) |
| InChIKey | HBWLFUCESGXPLG-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 106.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.42 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |