C17H23ClFN3O3 — CID 120856441
1-[5-[4-fluoro-3-(2-methoxyethoxymethyl)phenyl]-1,2,4-oxadiazol-3-yl]cyclopentan-1-amine;hydrochloride (PubChem CID 120856441) has the molecular formula C17H23ClFN3O3 and a molecular weight of 371.84 g/mol. Its IUPAC name is 1-[5-[4-fluoro-3-(2-methoxyethoxymethyl)phenyl]-1,2,4-oxadiazol-3-yl]cyclopentan-1-amine;hydrochloride.
| Compound Name | 1-[5-[4-fluoro-3-(2-methoxyethoxymethyl)phenyl]-1,2,4-oxadiazol-3-yl]cyclopentan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 120856441 |
| Molecular Formula | C17H23ClFN3O3 |
| Molecular Weight | 371.84 g/mol |
| Exact Mass | 371.14 |
| IUPAC Name | 1-[5-[4-fluoro-3-(2-methoxyethoxymethyl)phenyl]-1,2,4-oxadiazol-3-yl]cyclopentan-1-amine;hydrochloride |
| SMILES | COCCOCc1cc(-c2nc(C3(N)CCCC3)no2)ccc1F.Cl |
| InChI | InChI=1S/C17H22FN3O3.ClH/c1-22-8-9-23-11-13-10-12(4-5-14(13)18)15-20-16(21-24-15)17(19)6-2-3-7-17;/h4-5,10H,2-3,6-9,11,19H2,1H3;1H |
| InChIKey | DXJGQRQDRNPBQU-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 83.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.84 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|