C16H24N2O2S — CID 120858029
7-[(3-methylsulfonylazepan-1-yl)methyl]-2,3-dihydro-1H-indole (PubChem CID 120858029) has the molecular formula C16H24N2O2S and a molecular weight of 308.45 g/mol. Its IUPAC name is 7-[(3-methylsulfonylazepan-1-yl)methyl]-2,3-dihydro-1H-indole.
| Compound Name | 7-[(3-methylsulfonylazepan-1-yl)methyl]-2,3-dihydro-1H-indole |
|---|---|
| PubChem CID | 120858029 |
| Molecular Formula | C16H24N2O2S |
| Molecular Weight | 308.45 g/mol |
| Exact Mass | 308.16 |
| IUPAC Name | 7-[(3-methylsulfonylazepan-1-yl)methyl]-2,3-dihydro-1H-indole |
| SMILES | CS(=O)(=O)C1CCCCN(Cc2cccc3c2NCC3)C1 |
| InChI | InChI=1S/C16H24N2O2S/c1-21(19,20)15-7-2-3-10-18(12-15)11-14-6-4-5-13-8-9-17-16(13)14/h4-6,15,17H,2-3,7-12H2,1H3 |
| InChIKey | IUHIAXADDYTCNG-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.45 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |