C15H24BrClN2 — CID 120858313
N-[(2-bromophenyl)methyl]-N-(piperidin-4-ylmethyl)ethanamine;hydrochloride (PubChem CID 120858313) has the molecular formula C15H24BrClN2 and a molecular weight of 347.73 g/mol. Its IUPAC name is N-[(2-bromophenyl)methyl]-N-(piperidin-4-ylmethyl)ethanamine;hydrochloride.
| Compound Name | N-[(2-bromophenyl)methyl]-N-(piperidin-4-ylmethyl)ethanamine;hydrochloride |
|---|---|
| PubChem CID | 120858313 |
| Molecular Formula | C15H24BrClN2 |
| Molecular Weight | 347.73 g/mol |
| Exact Mass | 346.08 |
| IUPAC Name | N-[(2-bromophenyl)methyl]-N-(piperidin-4-ylmethyl)ethanamine;hydrochloride |
| SMILES | CCN(Cc1ccccc1Br)CC1CCNCC1.Cl |
| InChI | InChI=1S/C15H23BrN2.ClH/c1-2-18(11-13-7-9-17-10-8-13)12-14-5-3-4-6-15(14)16;/h3-6,13,17H,2,7-12H2,1H3;1H |
| InChIKey | JROHWYHCVROSDD-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.73 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |