C15H19N7O — CID 120858666
1-[5-[2-(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)ethyl]-1,2,4-oxadiazol-3-yl]cyclobutan-1-amine (PubChem CID 120858666) has the molecular formula C15H19N7O and a molecular weight of 313.37 g/mol. Its IUPAC name is 1-[5-[2-(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)ethyl]-1,2,4-oxadiazol-3-yl]cyclobutan-1-amine.
| Compound Name | 1-[5-[2-(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)ethyl]-1,2,4-oxadiazol-3-yl]cyclobutan-1-amine |
|---|---|
| PubChem CID | 120858666 |
| Molecular Formula | C15H19N7O |
| Molecular Weight | 313.37 g/mol |
| Exact Mass | 313.17 |
| IUPAC Name | 1-[5-[2-(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)ethyl]-1,2,4-oxadiazol-3-yl]cyclobutan-1-amine |
| SMILES | Cc1nc2ncnn2c(C)c1CCc1nc(C2(N)CCC2)no1 |
| InChI | InChI=1S/C15H19N7O/c1-9-11(10(2)22-14(19-9)17-8-18-22)4-5-12-20-13(21-23-12)15(16)6-3-7-15/h8H,3-7,16H2,1-2H3 |
| InChIKey | PGBYKJVDFBCFLD-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 108.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.37 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |