C12H20ClN3O2 — CID 120858997
1-[5-(1-but-3-enoxyethyl)-1,2,4-oxadiazol-3-yl]cyclobutan-1-amine;hydrochloride (PubChem CID 120858997) has the molecular formula C12H20ClN3O2 and a molecular weight of 273.76 g/mol. Its IUPAC name is 1-[5-(1-but-3-enoxyethyl)-1,2,4-oxadiazol-3-yl]cyclobutan-1-amine;hydrochloride.
| Compound Name | 1-[5-(1-but-3-enoxyethyl)-1,2,4-oxadiazol-3-yl]cyclobutan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 120858997 |
| Molecular Formula | C12H20ClN3O2 |
| Molecular Weight | 273.76 g/mol |
| Exact Mass | 273.12 |
| IUPAC Name | 1-[5-(1-but-3-enoxyethyl)-1,2,4-oxadiazol-3-yl]cyclobutan-1-amine;hydrochloride |
| SMILES | C=CCCOC(C)c1nc(C2(N)CCC2)no1.Cl |
| InChI | InChI=1S/C12H19N3O2.ClH/c1-3-4-8-16-9(2)10-14-11(15-17-10)12(13)6-5-7-12;/h3,9H,1,4-8,13H2,2H3;1H |
| InChIKey | HXAXMMGKFBLXMB-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 74.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.76 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|