C16H21N3O3 — CID 120859350
1-[5-(3,4-diethoxyphenyl)-1,2,4-oxadiazol-3-yl]cyclobutan-1-amine (PubChem CID 120859350) has the molecular formula C16H21N3O3 and a molecular weight of 303.36 g/mol. Its IUPAC name is 1-[5-(3,4-diethoxyphenyl)-1,2,4-oxadiazol-3-yl]cyclobutan-1-amine.
| Compound Name | 1-[5-(3,4-diethoxyphenyl)-1,2,4-oxadiazol-3-yl]cyclobutan-1-amine |
|---|---|
| PubChem CID | 120859350 |
| Molecular Formula | C16H21N3O3 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.16 |
| IUPAC Name | 1-[5-(3,4-diethoxyphenyl)-1,2,4-oxadiazol-3-yl]cyclobutan-1-amine |
| SMILES | CCOc1ccc(-c2nc(C3(N)CCC3)no2)cc1OCC |
| InChI | InChI=1S/C16H21N3O3/c1-3-20-12-7-6-11(10-13(12)21-4-2)14-18-15(19-22-14)16(17)8-5-9-16/h6-7,10H,3-5,8-9,17H2,1-2H3 |
| InChIKey | YPEWOTVPJPKORL-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 83.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |