C12H10Cl2FN3O — CID 120862076
1-[5-(2,4-dichloro-5-fluorophenyl)-1,2,4-oxadiazol-3-yl]cyclobutan-1-amine (PubChem CID 120862076) has the molecular formula C12H10Cl2FN3O and a molecular weight of 302.14 g/mol. Its IUPAC name is 1-[5-(2,4-dichloro-5-fluorophenyl)-1,2,4-oxadiazol-3-yl]cyclobutan-1-amine.
| Compound Name | 1-[5-(2,4-dichloro-5-fluorophenyl)-1,2,4-oxadiazol-3-yl]cyclobutan-1-amine |
|---|---|
| PubChem CID | 120862076 |
| Molecular Formula | C12H10Cl2FN3O |
| Molecular Weight | 302.14 g/mol |
| Exact Mass | 301.02 |
| IUPAC Name | 1-[5-(2,4-dichloro-5-fluorophenyl)-1,2,4-oxadiazol-3-yl]cyclobutan-1-amine |
| SMILES | NC1(c2noc(-c3cc(F)c(Cl)cc3Cl)n2)CCC1 |
| InChI | InChI=1S/C12H10Cl2FN3O/c13-7-5-8(14)9(15)4-6(7)10-17-11(18-19-10)12(16)2-1-3-12/h4-5H,1-3,16H2 |
| InChIKey | DOFBCQQGXLRHGI-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.14 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|