C10H15ClN4O2S — CID 120862737
3-[[3-(1-aminocyclobutyl)-1,2,4-oxadiazol-5-yl]methyl]-1,3-thiazolidin-2-one;hydrochloride (PubChem CID 120862737) has the molecular formula C10H15ClN4O2S and a molecular weight of 290.78 g/mol. Its IUPAC name is 3-[[3-(1-aminocyclobutyl)-1,2,4-oxadiazol-5-yl]methyl]-1,3-thiazolidin-2-one;hydrochloride.
| Compound Name | 3-[[3-(1-aminocyclobutyl)-1,2,4-oxadiazol-5-yl]methyl]-1,3-thiazolidin-2-one;hydrochloride |
|---|---|
| PubChem CID | 120862737 |
| Molecular Formula | C10H15ClN4O2S |
| Molecular Weight | 290.78 g/mol |
| Exact Mass | 290.06 |
| IUPAC Name | 3-[[3-(1-aminocyclobutyl)-1,2,4-oxadiazol-5-yl]methyl]-1,3-thiazolidin-2-one;hydrochloride |
| SMILES | Cl.NC1(c2noc(CN3CCSC3=O)n2)CCC1 |
| InChI | InChI=1S/C10H14N4O2S.ClH/c11-10(2-1-3-10)8-12-7(16-13-8)6-14-4-5-17-9(14)15;/h1-6,11H2;1H |
| InChIKey | ILAFLAQOWCVQEU-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.78 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|