C12H14Cl2N4O3 — CID 120866559
1-[5-(3-chloro-2-nitrophenyl)-1,2,4-oxadiazol-3-yl]-N-methylpropan-2-amine;hydrochloride (PubChem CID 120866559) has the molecular formula C12H14Cl2N4O3 and a molecular weight of 333.18 g/mol. Its IUPAC name is 1-[5-(3-chloro-2-nitrophenyl)-1,2,4-oxadiazol-3-yl]-N-methylpropan-2-amine;hydrochloride.
| Compound Name | 1-[5-(3-chloro-2-nitrophenyl)-1,2,4-oxadiazol-3-yl]-N-methylpropan-2-amine;hydrochloride |
|---|---|
| PubChem CID | 120866559 |
| Molecular Formula | C12H14Cl2N4O3 |
| Molecular Weight | 333.18 g/mol |
| Exact Mass | 332.04 |
| IUPAC Name | 1-[5-(3-chloro-2-nitrophenyl)-1,2,4-oxadiazol-3-yl]-N-methylpropan-2-amine;hydrochloride |
| SMILES | CNC(C)Cc1noc(-c2cccc(Cl)c2[N+](=O)[O-])n1.Cl |
| InChI | InChI=1S/C12H13ClN4O3.ClH/c1-7(14-2)6-10-15-12(20-16-10)8-4-3-5-9(13)11(8)17(18)19;/h3-5,7,14H,6H2,1-2H3;1H |
| InChIKey | IGKXXDDRPIYERT-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.18 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|