C17H21ClN4O3 — CID 120868313
3-[[4-[3-[2-(methylamino)propyl]-1,2,4-oxadiazol-5-yl]phenyl]methyl]pyrrolidine-2,5-dione;hydrochloride (PubChem CID 120868313) has the molecular formula C17H21ClN4O3 and a molecular weight of 364.83 g/mol. Its IUPAC name is 3-[[4-[3-[2-(methylamino)propyl]-1,2,4-oxadiazol-5-yl]phenyl]methyl]pyrrolidine-2,5-dione;hydrochloride.
| Compound Name | 3-[[4-[3-[2-(methylamino)propyl]-1,2,4-oxadiazol-5-yl]phenyl]methyl]pyrrolidine-2,5-dione;hydrochloride |
|---|---|
| PubChem CID | 120868313 |
| Molecular Formula | C17H21ClN4O3 |
| Molecular Weight | 364.83 g/mol |
| Exact Mass | 364.13 |
| IUPAC Name | 3-[[4-[3-[2-(methylamino)propyl]-1,2,4-oxadiazol-5-yl]phenyl]methyl]pyrrolidine-2,5-dione;hydrochloride |
| SMILES | CNC(C)Cc1noc(-c2ccc(CC3CC(=O)NC3=O)cc2)n1.Cl |
| InChI | InChI=1S/C17H20N4O3.ClH/c1-10(18-2)7-14-19-17(24-21-14)12-5-3-11(4-6-12)8-13-9-15(22)20-16(13)23;/h3-6,10,13,18H,7-9H2,1-2H3,(H,20,22,23);1H |
| InChIKey | IQSJQXJBZSNTNJ-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 97.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.83 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|