C16H20N6O3 — CID 120870399
2-[2-(1-methylimidazol-2-yl)piperazin-1-yl]-N-(2-nitrophenyl)acetamide (PubChem CID 120870399) has the molecular formula C16H20N6O3 and a molecular weight of 344.38 g/mol. Its IUPAC name is 2-[2-(1-methylimidazol-2-yl)piperazin-1-yl]-N-(2-nitrophenyl)acetamide.
| Compound Name | 2-[2-(1-methylimidazol-2-yl)piperazin-1-yl]-N-(2-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 120870399 |
| Molecular Formula | C16H20N6O3 |
| Molecular Weight | 344.38 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | 2-[2-(1-methylimidazol-2-yl)piperazin-1-yl]-N-(2-nitrophenyl)acetamide |
| SMILES | Cn1ccnc1C1CNCCN1CC(=O)Nc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H20N6O3/c1-20-8-7-18-16(20)14-10-17-6-9-21(14)11-15(23)19-12-4-2-3-5-13(12)22(24)25/h2-5,7-8,14,17H,6,9-11H2,1H3,(H,19,23) |
| InChIKey | FVUSYYHKWIMBCR-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 105.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.38 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|