C22H19ClFNO3 — CID 1208710
methyl 4-[(2-chloro-6-fluorophenyl)methylidene]-2-methyl-5-oxo-1-(2-phenylethyl)pyrrole-3-carboxylate (PubChem CID 1208710) has the molecular formula C22H19ClFNO3 and a molecular weight of 399.85 g/mol. Its IUPAC name is methyl 4-[(2-chloro-6-fluorophenyl)methylidene]-2-methyl-5-oxo-1-(2-phenylethyl)pyrrole-3-carboxylate.
| Compound Name | methyl 4-[(2-chloro-6-fluorophenyl)methylidene]-2-methyl-5-oxo-1-(2-phenylethyl)pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 1208710 |
| Molecular Formula | C22H19ClFNO3 |
| Molecular Weight | 399.85 g/mol |
| Exact Mass | 399.10 |
| IUPAC Name | methyl 4-[(2-chloro-6-fluorophenyl)methylidene]-2-methyl-5-oxo-1-(2-phenylethyl)pyrrole-3-carboxylate |
| SMILES | COC(=O)C1=C(C)N(CCc2ccccc2)C(=O)C1=Cc1c(F)cccc1Cl |
| InChI | InChI=1S/C22H19ClFNO3/c1-14-20(22(27)28-2)17(13-16-18(23)9-6-10-19(16)24)21(26)25(14)12-11-15-7-4-3-5-8-15/h3-10,13H,11-12H2,1-2H3 |
| InChIKey | ZYGWBEZJERVNLP-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.85 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|