C11H16N2O2 — CID 120872754
(2R)-2-amino-N-[2-(2-hydroxyphenyl)ethyl]propanamide (PubChem CID 120872754) has the molecular formula C11H16N2O2 and a molecular weight of 208.26 g/mol. Its IUPAC name is (2R)-2-amino-N-[2-(2-hydroxyphenyl)ethyl]propanamide.
| Compound Name | (2R)-2-amino-N-[2-(2-hydroxyphenyl)ethyl]propanamide |
|---|---|
| PubChem CID | 120872754 |
| Molecular Formula | C11H16N2O2 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.12 |
| IUPAC Name | (2R)-2-amino-N-[2-(2-hydroxyphenyl)ethyl]propanamide |
| SMILES | C[C@@H](N)C(=O)NCCc1ccccc1O |
| InChI | InChI=1S/C11H16N2O2/c1-8(12)11(15)13-7-6-9-4-2-3-5-10(9)14/h2-5,8,14H,6-7,12H2,1H3,(H,13,15)/t8-/m1/s1 |
| InChIKey | ACCKWACBNHHCEI-MRVPVSSYSA-N |
| XLogP | 0.40 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |