About 3-amino-N-[(3,4-diethyl-6-oxo-1H-pyridazin-5-yl)methyl]butanamide
3-amino-N-[(3,4-diethyl-6-oxo-1H-pyridazin-5-yl)methyl]butanamide (PubChem CID 120873070) has the molecular formula C13H22N4O2
and a molecular weight of 266.34 g/mol. Its IUPAC name is 3-amino-N-[(3,4-diethyl-6-oxo-1H-pyridazin-5-yl)methyl]butanamide.
Molecular Properties
| Compound Name | 3-amino-N-[(3,4-diethyl-6-oxo-1H-pyridazin-5-yl)methyl]butanamide |
| PubChem CID | 120873070 |
| Molecular Formula | C13H22N4O2 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.17 |
| IUPAC Name | 3-amino-N-[(3,4-diethyl-6-oxo-1H-pyridazin-5-yl)methyl]butanamide |
| SMILES | CCc1n[nH]c(=O)c(CNC(=O)CC(C)N)c1CC |
| InChI | InChI=1S/C13H22N4O2/c1-4-9-10(7-15-12(18)6-8(3)14)13(19)17-16-11(9)5-2/h8H,4-7,14H2,1-3H3,(H,15,18)(H,17,19) |
| InChIKey | MPCUESPNOCVXPF-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 100.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-amino-N-[(3,4-diethyl-6-oxo-1H-pyridazin-5-yl)methyl]butanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-N-[(3,4-diethyl-6-oxo-1H-pyridazin-5-yl)methyl]butanamide?
The IUPAC name of 3-amino-N-[(3,4-diethyl-6-oxo-1H-pyridazin-5-yl)methyl]butanamide (CID 120873070) is 3-amino-N-[(3,4-diethyl-6-oxo-1H-pyridazin-5-yl)methyl]butanamide.
What is the SMILES notation for 3-amino-N-[(3,4-diethyl-6-oxo-1H-pyridazin-5-yl)methyl]butanamide?
The canonical SMILES for 3-amino-N-[(3,4-diethyl-6-oxo-1H-pyridazin-5-yl)methyl]butanamide is CCc1n[nH]c(=O)c(CNC(=O)CC(C)N)c1CC.
What is the InChIKey of 3-amino-N-[(3,4-diethyl-6-oxo-1H-pyridazin-5-yl)methyl]butanamide?
The InChIKey is MPCUESPNOCVXPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22N4O2/c1-4-9-10(7-15-12(18)6-8(3)14)13(19)17-16-11(9)5-2/h8H,4-7,14H2,1-3H3,(H,15,18)(H,17,19).
What are the key properties of 3-amino-N-[(3,4-diethyl-6-oxo-1H-pyridazin-5-yl)methyl]butanamide?
3-amino-N-[(3,4-diethyl-6-oxo-1H-pyridazin-5-yl)methyl]butanamide has a molecular weight of 266.34 g/mol, XLogP of 0.25, 6 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-N-[(3,4-diethyl-6-oxo-1H-pyridazin-5-yl)methyl]butanamide is sourced from PubChem (CID 120873070), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).