C13H18Cl2FN3O — CID 120873636
(2R)-2-amino-1-[4-(2-chloro-4-fluorophenyl)piperazin-1-yl]propan-1-one;hydrochloride (PubChem CID 120873636) has the molecular formula C13H18Cl2FN3O and a molecular weight of 322.21 g/mol. Its IUPAC name is (2R)-2-amino-1-[4-(2-chloro-4-fluorophenyl)piperazin-1-yl]propan-1-one;hydrochloride.
| Compound Name | (2R)-2-amino-1-[4-(2-chloro-4-fluorophenyl)piperazin-1-yl]propan-1-one;hydrochloride |
|---|---|
| PubChem CID | 120873636 |
| Molecular Formula | C13H18Cl2FN3O |
| Molecular Weight | 322.21 g/mol |
| Exact Mass | 321.08 |
| IUPAC Name | (2R)-2-amino-1-[4-(2-chloro-4-fluorophenyl)piperazin-1-yl]propan-1-one;hydrochloride |
| SMILES | C[C@@H](N)C(=O)N1CCN(c2ccc(F)cc2Cl)CC1.Cl |
| InChI | InChI=1S/C13H17ClFN3O.ClH/c1-9(16)13(19)18-6-4-17(5-7-18)12-3-2-10(15)8-11(12)14;/h2-3,8-9H,4-7,16H2,1H3;1H/t9-;/m1./s1 |
| InChIKey | QUHBHFDBTGRWDY-SBSPUUFOSA-N |
| XLogP | 1.90 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.21 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |