C15H22N2O4S — CID 120874806
6-methyl-N-(1-piperidin-3-ylethyl)-1,3-benzodioxole-5-sulfonamide (PubChem CID 120874806) has the molecular formula C15H22N2O4S and a molecular weight of 326.42 g/mol. Its IUPAC name is 6-methyl-N-(1-piperidin-3-ylethyl)-1,3-benzodioxole-5-sulfonamide.
| Compound Name | 6-methyl-N-(1-piperidin-3-ylethyl)-1,3-benzodioxole-5-sulfonamide |
|---|---|
| PubChem CID | 120874806 |
| Molecular Formula | C15H22N2O4S |
| Molecular Weight | 326.42 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | 6-methyl-N-(1-piperidin-3-ylethyl)-1,3-benzodioxole-5-sulfonamide |
| SMILES | Cc1cc2c(cc1S(=O)(=O)NC(C)C1CCCNC1)OCO2 |
| InChI | InChI=1S/C15H22N2O4S/c1-10-6-13-14(21-9-20-13)7-15(10)22(18,19)17-11(2)12-4-3-5-16-8-12/h6-7,11-12,16-17H,3-5,8-9H2,1-2H3 |
| InChIKey | MLAVTYIKJQNJHN-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.42 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |