C13H17Cl2N3O2S — CID 120875104
3-chloro-4-[4-(methylamino)piperidin-1-yl]sulfonylbenzonitrile;hydrochloride (PubChem CID 120875104) has the molecular formula C13H17Cl2N3O2S and a molecular weight of 350.27 g/mol. Its IUPAC name is 3-chloro-4-[4-(methylamino)piperidin-1-yl]sulfonylbenzonitrile;hydrochloride.
| Compound Name | 3-chloro-4-[4-(methylamino)piperidin-1-yl]sulfonylbenzonitrile;hydrochloride |
|---|---|
| PubChem CID | 120875104 |
| Molecular Formula | C13H17Cl2N3O2S |
| Molecular Weight | 350.27 g/mol |
| Exact Mass | 349.04 |
| IUPAC Name | 3-chloro-4-[4-(methylamino)piperidin-1-yl]sulfonylbenzonitrile;hydrochloride |
| SMILES | CNC1CCN(S(=O)(=O)c2ccc(C#N)cc2Cl)CC1.Cl |
| InChI | InChI=1S/C13H16ClN3O2S.ClH/c1-16-11-4-6-17(7-5-11)20(18,19)13-3-2-10(9-15)8-12(13)14;/h2-3,8,11,16H,4-7H2,1H3;1H |
| InChIKey | UCHJPPRUPFEVOA-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.27 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |