About 1-[(3-ethyl-[1,2]oxazolo[5,4-b]pyridin-5-yl)sulfonyl]-N-methylpiperidin-4-amine
1-[(3-ethyl-[1,2]oxazolo[5,4-b]pyridin-5-yl)sulfonyl]-N-methylpiperidin-4-amine (PubChem CID 120875109) has the molecular formula C14H20N4O3S
and a molecular weight of 324.41 g/mol. Its IUPAC name is 1-[(3-ethyl-[1,2]oxazolo[5,4-b]pyridin-5-yl)sulfonyl]-N-methylpiperidin-4-amine.
Molecular Properties
| Compound Name | 1-[(3-ethyl-[1,2]oxazolo[5,4-b]pyridin-5-yl)sulfonyl]-N-methylpiperidin-4-amine |
| PubChem CID | 120875109 |
| Molecular Formula | C14H20N4O3S |
| Molecular Weight | 324.41 g/mol |
| Exact Mass | 324.13 |
| IUPAC Name | 1-[(3-ethyl-[1,2]oxazolo[5,4-b]pyridin-5-yl)sulfonyl]-N-methylpiperidin-4-amine |
| SMILES | CCc1noc2ncc(S(=O)(=O)N3CCC(NC)CC3)cc12 |
| InChI | InChI=1S/C14H20N4O3S/c1-3-13-12-8-11(9-16-14(12)21-17-13)22(19,20)18-6-4-10(15-2)5-7-18/h8-10,15H,3-7H2,1-2H3 |
| InChIKey | GHTNQDSWNAIDGB-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 88.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.41 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-[(3-ethyl-[1,2]oxazolo[5,4-b]pyridin-5-yl)sulfonyl]-N-methylpiperidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3-ethyl-[1,2]oxazolo[5,4-b]pyridin-5-yl)sulfonyl]-N-methylpiperidin-4-amine?
The IUPAC name of 1-[(3-ethyl-[1,2]oxazolo[5,4-b]pyridin-5-yl)sulfonyl]-N-methylpiperidin-4-amine (CID 120875109) is 1-[(3-ethyl-[1,2]oxazolo[5,4-b]pyridin-5-yl)sulfonyl]-N-methylpiperidin-4-amine.
What is the SMILES notation for 1-[(3-ethyl-[1,2]oxazolo[5,4-b]pyridin-5-yl)sulfonyl]-N-methylpiperidin-4-amine?
The canonical SMILES for 1-[(3-ethyl-[1,2]oxazolo[5,4-b]pyridin-5-yl)sulfonyl]-N-methylpiperidin-4-amine is CCc1noc2ncc(S(=O)(=O)N3CCC(NC)CC3)cc12.
What is the InChIKey of 1-[(3-ethyl-[1,2]oxazolo[5,4-b]pyridin-5-yl)sulfonyl]-N-methylpiperidin-4-amine?
The InChIKey is GHTNQDSWNAIDGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20N4O3S/c1-3-13-12-8-11(9-16-14(12)21-17-13)22(19,20)18-6-4-10(15-2)5-7-18/h8-10,15H,3-7H2,1-2H3.
What are the key properties of 1-[(3-ethyl-[1,2]oxazolo[5,4-b]pyridin-5-yl)sulfonyl]-N-methylpiperidin-4-amine?
1-[(3-ethyl-[1,2]oxazolo[5,4-b]pyridin-5-yl)sulfonyl]-N-methylpiperidin-4-amine has a molecular weight of 324.41 g/mol, XLogP of 1.16, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3-ethyl-[1,2]oxazolo[5,4-b]pyridin-5-yl)sulfonyl]-N-methylpiperidin-4-amine is sourced from PubChem (CID 120875109), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).