About N-[1-(aminomethyl)cyclopentyl]-4,4,4-trifluorobutane-1-sulfonamide;hydrochloride
N-[1-(aminomethyl)cyclopentyl]-4,4,4-trifluorobutane-1-sulfonamide;hydrochloride (PubChem CID 120875154) has the molecular formula C10H20ClF3N2O2S
and a molecular weight of 324.80 g/mol. Its IUPAC name is N-[1-(aminomethyl)cyclopentyl]-4,4,4-trifluorobutane-1-sulfonamide;hydrochloride.
Molecular Properties
| Compound Name | N-[1-(aminomethyl)cyclopentyl]-4,4,4-trifluorobutane-1-sulfonamide;hydrochloride |
| PubChem CID | 120875154 |
| Molecular Formula | C10H20ClF3N2O2S |
| Molecular Weight | 324.80 g/mol |
| Exact Mass | 324.09 |
| IUPAC Name | N-[1-(aminomethyl)cyclopentyl]-4,4,4-trifluorobutane-1-sulfonamide;hydrochloride |
| SMILES | Cl.NCC1(NS(=O)(=O)CCCC(F)(F)F)CCCC1 |
| InChI | InChI=1S/C10H19F3N2O2S.ClH/c11-10(12,13)6-3-7-18(16,17)15-9(8-14)4-1-2-5-9;/h15H,1-8,14H2;1H |
| InChIKey | LBAPMMVEWGTLPF-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.80 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[1-(aminomethyl)cyclopentyl]-4,4,4-trifluorobutane-1-sulfonamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-(aminomethyl)cyclopentyl]-4,4,4-trifluorobutane-1-sulfonamide;hydrochloride?
The IUPAC name of N-[1-(aminomethyl)cyclopentyl]-4,4,4-trifluorobutane-1-sulfonamide;hydrochloride (CID 120875154) is N-[1-(aminomethyl)cyclopentyl]-4,4,4-trifluorobutane-1-sulfonamide;hydrochloride.
What is the SMILES notation for N-[1-(aminomethyl)cyclopentyl]-4,4,4-trifluorobutane-1-sulfonamide;hydrochloride?
The canonical SMILES for N-[1-(aminomethyl)cyclopentyl]-4,4,4-trifluorobutane-1-sulfonamide;hydrochloride is Cl.NCC1(NS(=O)(=O)CCCC(F)(F)F)CCCC1.
What is the InChIKey of N-[1-(aminomethyl)cyclopentyl]-4,4,4-trifluorobutane-1-sulfonamide;hydrochloride?
The InChIKey is LBAPMMVEWGTLPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19F3N2O2S.ClH/c11-10(12,13)6-3-7-18(16,17)15-9(8-14)4-1-2-5-9;/h15H,1-8,14H2;1H.
What are the key properties of N-[1-(aminomethyl)cyclopentyl]-4,4,4-trifluorobutane-1-sulfonamide;hydrochloride?
N-[1-(aminomethyl)cyclopentyl]-4,4,4-trifluorobutane-1-sulfonamide;hydrochloride has a molecular weight of 324.80 g/mol, XLogP of 1.94, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-(aminomethyl)cyclopentyl]-4,4,4-trifluorobutane-1-sulfonamide;hydrochloride is sourced from PubChem (CID 120875154), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).