C14H22F3N5O2S — CID 120876984
N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridine-2-sulfonamide (PubChem CID 120876984) has the molecular formula C14H22F3N5O2S and a molecular weight of 381.42 g/mol. Its IUPAC name is N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridine-2-sulfonamide.
| Compound Name | N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridine-2-sulfonamide |
|---|---|
| PubChem CID | 120876984 |
| Molecular Formula | C14H22F3N5O2S |
| Molecular Weight | 381.42 g/mol |
| Exact Mass | 381.14 |
| IUPAC Name | N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridine-2-sulfonamide |
| SMILES | O=S(=O)(NCC(N1CCNCC1)C(F)(F)F)c1cn2c(n1)CCCC2 |
| InChI | InChI=1S/C14H22F3N5O2S/c15-14(16,17)11(21-7-4-18-5-8-21)9-19-25(23,24)13-10-22-6-2-1-3-12(22)20-13/h10-11,18-19H,1-9H2 |
| InChIKey | AQHHVVLRYPOKMP-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 79.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.42 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |