About methyl 2-(4-amino-3,3-dimethylpiperidin-1-yl)sulfonylcyclohexane-1-carboxylate;hydrochloride
methyl 2-(4-amino-3,3-dimethylpiperidin-1-yl)sulfonylcyclohexane-1-carboxylate;hydrochloride (PubChem CID 120876999) has the molecular formula C15H29ClN2O4S
and a molecular weight of 368.93 g/mol. Its IUPAC name is methyl 2-(4-amino-3,3-dimethylpiperidin-1-yl)sulfonylcyclohexane-1-carboxylate;hydrochloride.
Molecular Properties
| Compound Name | methyl 2-(4-amino-3,3-dimethylpiperidin-1-yl)sulfonylcyclohexane-1-carboxylate;hydrochloride |
| PubChem CID | 120876999 |
| Molecular Formula | C15H29ClN2O4S |
| Molecular Weight | 368.93 g/mol |
| Exact Mass | 368.15 |
| IUPAC Name | methyl 2-(4-amino-3,3-dimethylpiperidin-1-yl)sulfonylcyclohexane-1-carboxylate;hydrochloride |
| SMILES | COC(=O)C1CCCCC1S(=O)(=O)N1CCC(N)C(C)(C)C1.Cl |
| InChI | InChI=1S/C15H28N2O4S.ClH/c1-15(2)10-17(9-8-13(15)16)22(19,20)12-7-5-4-6-11(12)14(18)21-3;/h11-13H,4-10,16H2,1-3H3;1H |
| InChIKey | KIRYVATZUCRUID-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.93 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 2-(4-amino-3,3-dimethylpiperidin-1-yl)sulfonylcyclohexane-1-carboxylate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-(4-amino-3,3-dimethylpiperidin-1-yl)sulfonylcyclohexane-1-carboxylate;hydrochloride?
The IUPAC name of methyl 2-(4-amino-3,3-dimethylpiperidin-1-yl)sulfonylcyclohexane-1-carboxylate;hydrochloride (CID 120876999) is methyl 2-(4-amino-3,3-dimethylpiperidin-1-yl)sulfonylcyclohexane-1-carboxylate;hydrochloride.
What is the SMILES notation for methyl 2-(4-amino-3,3-dimethylpiperidin-1-yl)sulfonylcyclohexane-1-carboxylate;hydrochloride?
The canonical SMILES for methyl 2-(4-amino-3,3-dimethylpiperidin-1-yl)sulfonylcyclohexane-1-carboxylate;hydrochloride is COC(=O)C1CCCCC1S(=O)(=O)N1CCC(N)C(C)(C)C1.Cl.
What is the InChIKey of methyl 2-(4-amino-3,3-dimethylpiperidin-1-yl)sulfonylcyclohexane-1-carboxylate;hydrochloride?
The InChIKey is KIRYVATZUCRUID-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H28N2O4S.ClH/c1-15(2)10-17(9-8-13(15)16)22(19,20)12-7-5-4-6-11(12)14(18)21-3;/h11-13H,4-10,16H2,1-3H3;1H.
What are the key properties of methyl 2-(4-amino-3,3-dimethylpiperidin-1-yl)sulfonylcyclohexane-1-carboxylate;hydrochloride?
methyl 2-(4-amino-3,3-dimethylpiperidin-1-yl)sulfonylcyclohexane-1-carboxylate;hydrochloride has a molecular weight of 368.93 g/mol, XLogP of 1.53, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(4-amino-3,3-dimethylpiperidin-1-yl)sulfonylcyclohexane-1-carboxylate;hydrochloride is sourced from PubChem (CID 120876999), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).