About 4-formylbenzoic acid
4-formylbenzoic acid (PubChem CID 12088) has the molecular formula C8H6O3
and a molecular weight of 150.13 g/mol. Its IUPAC name is 4-formylbenzoic acid.
Molecular Properties
| Compound Name | 4-formylbenzoic acid |
| PubChem CID | 12088 |
| Molecular Formula | C8H6O3 |
| Molecular Weight | 150.13 g/mol |
| Exact Mass | 150.03 |
| IUPAC Name | 4-formylbenzoic acid |
| SMILES | O=Cc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C8H6O3/c9-5-6-1-3-7(4-2-6)8(10)11/h1-5H,(H,10,11) |
| InChIKey | GOUHYARYYWKXHS-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.13 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 4-formylbenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-formylbenzoic acid?
The IUPAC name of 4-formylbenzoic acid (CID 12088) is 4-formylbenzoic acid.
What is the SMILES notation for 4-formylbenzoic acid?
The canonical SMILES for 4-formylbenzoic acid is O=Cc1ccc(C(=O)O)cc1.
What is the InChIKey of 4-formylbenzoic acid?
The InChIKey is GOUHYARYYWKXHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6O3/c9-5-6-1-3-7(4-2-6)8(10)11/h1-5H,(H,10,11).
What are the key properties of 4-formylbenzoic acid?
4-formylbenzoic acid has a molecular weight of 150.13 g/mol, XLogP of 1.20, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-formylbenzoic acid is sourced from PubChem (CID 12088), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).