C14H15ClFN5O3 — CID 120881017
N-(5-fluoro-1,2,3,4-tetrahydroisoquinolin-6-yl)-2-(4-nitropyrazol-1-yl)acetamide;hydrochloride (PubChem CID 120881017) has the molecular formula C14H15ClFN5O3 and a molecular weight of 355.76 g/mol. Its IUPAC name is N-(5-fluoro-1,2,3,4-tetrahydroisoquinolin-6-yl)-2-(4-nitropyrazol-1-yl)acetamide;hydrochloride.
| Compound Name | N-(5-fluoro-1,2,3,4-tetrahydroisoquinolin-6-yl)-2-(4-nitropyrazol-1-yl)acetamide;hydrochloride |
|---|---|
| PubChem CID | 120881017 |
| Molecular Formula | C14H15ClFN5O3 |
| Molecular Weight | 355.76 g/mol |
| Exact Mass | 355.08 |
| IUPAC Name | N-(5-fluoro-1,2,3,4-tetrahydroisoquinolin-6-yl)-2-(4-nitropyrazol-1-yl)acetamide;hydrochloride |
| SMILES | Cl.O=C(Cn1cc([N+](=O)[O-])cn1)Nc1ccc2c(c1F)CCNC2 |
| InChI | InChI=1S/C14H14FN5O3.ClH/c15-14-11-3-4-16-5-9(11)1-2-12(14)18-13(21)8-19-7-10(6-17-19)20(22)23;/h1-2,6-7,16H,3-5,8H2,(H,18,21);1H |
| InChIKey | JFYDGEQSTLEJQK-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 102.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.76 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|