C17H17Cl2F4N3O2 — CID 120881971
N-(5-fluoro-1,2,3,4-tetrahydroisoquinolin-6-yl)-2-(2,2,2-trifluoroethoxy)pyridine-3-carboxamide;dihydrochloride (PubChem CID 120881971) has the molecular formula C17H17Cl2F4N3O2 and a molecular weight of 442.24 g/mol. Its IUPAC name is N-(5-fluoro-1,2,3,4-tetrahydroisoquinolin-6-yl)-2-(2,2,2-trifluoroethoxy)pyridine-3-carboxamide;dihydrochloride.
| Compound Name | N-(5-fluoro-1,2,3,4-tetrahydroisoquinolin-6-yl)-2-(2,2,2-trifluoroethoxy)pyridine-3-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 120881971 |
| Molecular Formula | C17H17Cl2F4N3O2 |
| Molecular Weight | 442.24 g/mol |
| Exact Mass | 441.06 |
| IUPAC Name | N-(5-fluoro-1,2,3,4-tetrahydroisoquinolin-6-yl)-2-(2,2,2-trifluoroethoxy)pyridine-3-carboxamide;dihydrochloride |
| SMILES | Cl.Cl.O=C(Nc1ccc2c(c1F)CCNC2)c1cccnc1OCC(F)(F)F |
| InChI | InChI=1S/C17H15F4N3O2.2ClH/c18-14-11-5-7-22-8-10(11)3-4-13(14)24-15(25)12-2-1-6-23-16(12)26-9-17(19,20)21;;/h1-4,6,22H,5,7-9H2,(H,24,25);2*1H |
| InChIKey | ATCDKEWQXRGNBP-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.24 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |