C18H18Cl2FN3O4 — CID 120882507
2-(4-chloro-2-nitrophenoxy)-N-(5-fluoro-1,2,3,4-tetrahydroisoquinolin-6-yl)propanamide;hydrochloride (PubChem CID 120882507) has the molecular formula C18H18Cl2FN3O4 and a molecular weight of 430.26 g/mol. Its IUPAC name is 2-(4-chloro-2-nitrophenoxy)-N-(5-fluoro-1,2,3,4-tetrahydroisoquinolin-6-yl)propanamide;hydrochloride.
| Compound Name | 2-(4-chloro-2-nitrophenoxy)-N-(5-fluoro-1,2,3,4-tetrahydroisoquinolin-6-yl)propanamide;hydrochloride |
|---|---|
| PubChem CID | 120882507 |
| Molecular Formula | C18H18Cl2FN3O4 |
| Molecular Weight | 430.26 g/mol |
| Exact Mass | 429.07 |
| IUPAC Name | 2-(4-chloro-2-nitrophenoxy)-N-(5-fluoro-1,2,3,4-tetrahydroisoquinolin-6-yl)propanamide;hydrochloride |
| SMILES | CC(Oc1ccc(Cl)cc1[N+](=O)[O-])C(=O)Nc1ccc2c(c1F)CCNC2.Cl |
| InChI | InChI=1S/C18H17ClFN3O4.ClH/c1-10(27-16-5-3-12(19)8-15(16)23(25)26)18(24)22-14-4-2-11-9-21-7-6-13(11)17(14)20;/h2-5,8,10,21H,6-7,9H2,1H3,(H,22,24);1H |
| InChIKey | RRTZQQGMCGLURU-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 93.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.26 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|