C21H26Cl2FN5O2 — CID 120883017
N-(5-fluoro-1,2,3,4-tetrahydroisoquinolin-6-yl)-3-(1,4,6-trimethyl-3-oxo-2H-pyrazolo[3,4-b]pyridin-5-yl)propanamide;dihydrochloride (PubChem CID 120883017) has the molecular formula C21H26Cl2FN5O2 and a molecular weight of 470.38 g/mol. Its IUPAC name is N-(5-fluoro-1,2,3,4-tetrahydroisoquinolin-6-yl)-3-(1,4,6-trimethyl-3-oxo-2H-pyrazolo[3,4-b]pyridin-5-yl)propanamide;dihydrochloride.
| Compound Name | N-(5-fluoro-1,2,3,4-tetrahydroisoquinolin-6-yl)-3-(1,4,6-trimethyl-3-oxo-2H-pyrazolo[3,4-b]pyridin-5-yl)propanamide;dihydrochloride |
|---|---|
| PubChem CID | 120883017 |
| Molecular Formula | C21H26Cl2FN5O2 |
| Molecular Weight | 470.38 g/mol |
| Exact Mass | 469.14 |
| IUPAC Name | N-(5-fluoro-1,2,3,4-tetrahydroisoquinolin-6-yl)-3-(1,4,6-trimethyl-3-oxo-2H-pyrazolo[3,4-b]pyridin-5-yl)propanamide;dihydrochloride |
| SMILES | Cc1nc2c(c(C)c1CCC(=O)Nc1ccc3c(c1F)CCNC3)c(=O)[nH]n2C.Cl.Cl |
| InChI | InChI=1S/C21H24FN5O2.2ClH/c1-11-14(12(2)24-20-18(11)21(29)26-27(20)3)5-7-17(28)25-16-6-4-13-10-23-9-8-15(13)19(16)22;;/h4,6,23H,5,7-10H2,1-3H3,(H,25,28)(H,26,29);2*1H |
| InChIKey | VSFTZSGBOYRXBO-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 91.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.38 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |