C20H22Cl2FN5O3 — CID 120883227
N-(5-fluoro-1,2,3,4-tetrahydroisoquinolin-6-yl)-1,3,5-trimethyl-2,4-dioxopyrido[2,3-d]pyrimidine-7-carboxamide;dihydrochloride (PubChem CID 120883227) has the molecular formula C20H22Cl2FN5O3 and a molecular weight of 470.33 g/mol. Its IUPAC name is N-(5-fluoro-1,2,3,4-tetrahydroisoquinolin-6-yl)-1,3,5-trimethyl-2,4-dioxopyrido[2,3-d]pyrimidine-7-carboxamide;dihydrochloride.
| Compound Name | N-(5-fluoro-1,2,3,4-tetrahydroisoquinolin-6-yl)-1,3,5-trimethyl-2,4-dioxopyrido[2,3-d]pyrimidine-7-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 120883227 |
| Molecular Formula | C20H22Cl2FN5O3 |
| Molecular Weight | 470.33 g/mol |
| Exact Mass | 469.11 |
| IUPAC Name | N-(5-fluoro-1,2,3,4-tetrahydroisoquinolin-6-yl)-1,3,5-trimethyl-2,4-dioxopyrido[2,3-d]pyrimidine-7-carboxamide;dihydrochloride |
| SMILES | Cc1cc(C(=O)Nc2ccc3c(c2F)CCNC3)nc2c1c(=O)n(C)c(=O)n2C.Cl.Cl |
| InChI | InChI=1S/C20H20FN5O3.2ClH/c1-10-8-14(23-17-15(10)19(28)26(3)20(29)25(17)2)18(27)24-13-5-4-11-9-22-7-6-12(11)16(13)21;;/h4-5,8,22H,6-7,9H2,1-3H3,(H,24,27);2*1H |
| InChIKey | PIHNFNZWLWIAGS-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 98.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.33 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |