C16H17F4N3O2 — CID 120883934
N-(5-fluoro-1,2,3,4-tetrahydroisoquinolin-6-yl)-2-oxo-6-(trifluoromethyl)piperidine-3-carboxamide (PubChem CID 120883934) has the molecular formula C16H17F4N3O2 and a molecular weight of 359.32 g/mol. Its IUPAC name is N-(5-fluoro-1,2,3,4-tetrahydroisoquinolin-6-yl)-2-oxo-6-(trifluoromethyl)piperidine-3-carboxamide.
| Compound Name | N-(5-fluoro-1,2,3,4-tetrahydroisoquinolin-6-yl)-2-oxo-6-(trifluoromethyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 120883934 |
| Molecular Formula | C16H17F4N3O2 |
| Molecular Weight | 359.32 g/mol |
| Exact Mass | 359.13 |
| IUPAC Name | N-(5-fluoro-1,2,3,4-tetrahydroisoquinolin-6-yl)-2-oxo-6-(trifluoromethyl)piperidine-3-carboxamide |
| SMILES | O=C(Nc1ccc2c(c1F)CCNC2)C1CCC(C(F)(F)F)NC1=O |
| InChI | InChI=1S/C16H17F4N3O2/c17-13-9-5-6-21-7-8(9)1-3-11(13)22-14(24)10-2-4-12(16(18,19)20)23-15(10)25/h1,3,10,12,21H,2,4-7H2,(H,22,24)(H,23,25) |
| InChIKey | KKGSPJUNNBBXGV-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.32 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|