C17H17FN4O3S — CID 120884212
N-(5-fluoro-1,2,3,4-tetrahydroisoquinolin-6-yl)-2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-7-carboxamide (PubChem CID 120884212) has the molecular formula C17H17FN4O3S and a molecular weight of 376.41 g/mol. Its IUPAC name is N-(5-fluoro-1,2,3,4-tetrahydroisoquinolin-6-yl)-2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-7-carboxamide.
| Compound Name | N-(5-fluoro-1,2,3,4-tetrahydroisoquinolin-6-yl)-2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-7-carboxamide |
|---|---|
| PubChem CID | 120884212 |
| Molecular Formula | C17H17FN4O3S |
| Molecular Weight | 376.41 g/mol |
| Exact Mass | 376.10 |
| IUPAC Name | N-(5-fluoro-1,2,3,4-tetrahydroisoquinolin-6-yl)-2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-7-carboxamide |
| SMILES | O=C(Nc1ccc2c(c1F)CCNC2)C1=CN2CCS(=O)(=O)N=C2C=C1 |
| InChI | InChI=1S/C17H17FN4O3S/c18-16-13-5-6-19-9-11(13)1-3-14(16)20-17(23)12-2-4-15-21-26(24,25)8-7-22(15)10-12/h1-4,10,19H,5-9H2,(H,20,23) |
| InChIKey | CEJGHNDTSIFWLI-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.41 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |