C19H24ClN3O4 — CID 120884383
N-(2-aminoethyl)-4-ethoxy-3-nitro-N-(2-phenylethyl)benzamide;hydrochloride (PubChem CID 120884383) has the molecular formula C19H24ClN3O4 and a molecular weight of 393.87 g/mol. Its IUPAC name is N-(2-aminoethyl)-4-ethoxy-3-nitro-N-(2-phenylethyl)benzamide;hydrochloride.
| Compound Name | N-(2-aminoethyl)-4-ethoxy-3-nitro-N-(2-phenylethyl)benzamide;hydrochloride |
|---|---|
| PubChem CID | 120884383 |
| Molecular Formula | C19H24ClN3O4 |
| Molecular Weight | 393.87 g/mol |
| Exact Mass | 393.15 |
| IUPAC Name | N-(2-aminoethyl)-4-ethoxy-3-nitro-N-(2-phenylethyl)benzamide;hydrochloride |
| SMILES | CCOc1ccc(C(=O)N(CCN)CCc2ccccc2)cc1[N+](=O)[O-].Cl |
| InChI | InChI=1S/C19H23N3O4.ClH/c1-2-26-18-9-8-16(14-17(18)22(24)25)19(23)21(13-11-20)12-10-15-6-4-3-5-7-15;/h3-9,14H,2,10-13,20H2,1H3;1H |
| InChIKey | ISNJLMUBZMTQFZ-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 98.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.87 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|