C22H32Cl2N4O — CID 120884645
N-(2-aminoethyl)-6-(azepan-1-yl)-N-(2-phenylethyl)pyridine-3-carboxamide;dihydrochloride (PubChem CID 120884645) has the molecular formula C22H32Cl2N4O and a molecular weight of 439.43 g/mol. Its IUPAC name is N-(2-aminoethyl)-6-(azepan-1-yl)-N-(2-phenylethyl)pyridine-3-carboxamide;dihydrochloride.
| Compound Name | N-(2-aminoethyl)-6-(azepan-1-yl)-N-(2-phenylethyl)pyridine-3-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 120884645 |
| Molecular Formula | C22H32Cl2N4O |
| Molecular Weight | 439.43 g/mol |
| Exact Mass | 438.20 |
| IUPAC Name | N-(2-aminoethyl)-6-(azepan-1-yl)-N-(2-phenylethyl)pyridine-3-carboxamide;dihydrochloride |
| SMILES | Cl.Cl.NCCN(CCc1ccccc1)C(=O)c1ccc(N2CCCCCC2)nc1 |
| InChI | InChI=1S/C22H30N4O.2ClH/c23-13-17-26(16-12-19-8-4-3-5-9-19)22(27)20-10-11-21(24-18-20)25-14-6-1-2-7-15-25;;/h3-5,8-11,18H,1-2,6-7,12-17,23H2;2*1H |
| InChIKey | OMFPLOZKFCYYSP-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 62.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.43 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |