C16H20Cl2FN3O — CID 120885347
N-(2-aminoethyl)-5-fluoro-N-(2-phenylethyl)pyridine-3-carboxamide;dihydrochloride (PubChem CID 120885347) has the molecular formula C16H20Cl2FN3O and a molecular weight of 360.26 g/mol. Its IUPAC name is N-(2-aminoethyl)-5-fluoro-N-(2-phenylethyl)pyridine-3-carboxamide;dihydrochloride.
| Compound Name | N-(2-aminoethyl)-5-fluoro-N-(2-phenylethyl)pyridine-3-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 120885347 |
| Molecular Formula | C16H20Cl2FN3O |
| Molecular Weight | 360.26 g/mol |
| Exact Mass | 359.10 |
| IUPAC Name | N-(2-aminoethyl)-5-fluoro-N-(2-phenylethyl)pyridine-3-carboxamide;dihydrochloride |
| SMILES | Cl.Cl.NCCN(CCc1ccccc1)C(=O)c1cncc(F)c1 |
| InChI | InChI=1S/C16H18FN3O.2ClH/c17-15-10-14(11-19-12-15)16(21)20(9-7-18)8-6-13-4-2-1-3-5-13;;/h1-5,10-12H,6-9,18H2;2*1H |
| InChIKey | ZZZURQKHHKGOSG-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.26 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |