C17H26N4O2 — CID 120885796
3-N-(2-aminoethyl)-3-N-(2-phenylethyl)piperidine-1,3-dicarboxamide (PubChem CID 120885796) has the molecular formula C17H26N4O2 and a molecular weight of 318.42 g/mol. Its IUPAC name is 3-N-(2-aminoethyl)-3-N-(2-phenylethyl)piperidine-1,3-dicarboxamide.
| Compound Name | 3-N-(2-aminoethyl)-3-N-(2-phenylethyl)piperidine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 120885796 |
| Molecular Formula | C17H26N4O2 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.21 |
| IUPAC Name | 3-N-(2-aminoethyl)-3-N-(2-phenylethyl)piperidine-1,3-dicarboxamide |
| SMILES | NCCN(CCc1ccccc1)C(=O)C1CCCN(C(N)=O)C1 |
| InChI | InChI=1S/C17H26N4O2/c18-9-12-20(11-8-14-5-2-1-3-6-14)16(22)15-7-4-10-21(13-15)17(19)23/h1-3,5-6,15H,4,7-13,18H2,(H2,19,23) |
| InChIKey | OERWKYUQSLIEFE-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 92.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |