C20H21N3O3 — CID 120886128
N-(2-aminoethyl)-2-methyl-1,3-dioxo-N-(2-phenylethyl)isoindole-5-carboxamide (PubChem CID 120886128) has the molecular formula C20H21N3O3 and a molecular weight of 351.41 g/mol. Its IUPAC name is N-(2-aminoethyl)-2-methyl-1,3-dioxo-N-(2-phenylethyl)isoindole-5-carboxamide.
| Compound Name | N-(2-aminoethyl)-2-methyl-1,3-dioxo-N-(2-phenylethyl)isoindole-5-carboxamide |
|---|---|
| PubChem CID | 120886128 |
| Molecular Formula | C20H21N3O3 |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.16 |
| IUPAC Name | N-(2-aminoethyl)-2-methyl-1,3-dioxo-N-(2-phenylethyl)isoindole-5-carboxamide |
| SMILES | CN1C(=O)c2ccc(C(=O)N(CCN)CCc3ccccc3)cc2C1=O |
| InChI | InChI=1S/C20H21N3O3/c1-22-19(25)16-8-7-15(13-17(16)20(22)26)18(24)23(12-10-21)11-9-14-5-3-2-4-6-14/h2-8,13H,9-12,21H2,1H3 |
| InChIKey | GMVLGIXRDKCNHN-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 83.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|