C16H19N3O2S — CID 120886240
2-N-(2-aminoethyl)-2-N-(2-phenylethyl)thiophene-2,5-dicarboxamide (PubChem CID 120886240) has the molecular formula C16H19N3O2S and a molecular weight of 317.41 g/mol. Its IUPAC name is 2-N-(2-aminoethyl)-2-N-(2-phenylethyl)thiophene-2,5-dicarboxamide.
| Compound Name | 2-N-(2-aminoethyl)-2-N-(2-phenylethyl)thiophene-2,5-dicarboxamide |
|---|---|
| PubChem CID | 120886240 |
| Molecular Formula | C16H19N3O2S |
| Molecular Weight | 317.41 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | 2-N-(2-aminoethyl)-2-N-(2-phenylethyl)thiophene-2,5-dicarboxamide |
| SMILES | NCCN(CCc1ccccc1)C(=O)c1ccc(C(N)=O)s1 |
| InChI | InChI=1S/C16H19N3O2S/c17-9-11-19(10-8-12-4-2-1-3-5-12)16(21)14-7-6-13(22-14)15(18)20/h1-7H,8-11,17H2,(H2,18,20) |
| InChIKey | XFKDEHWJVFIXJT-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 89.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.41 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |