C19H22F2N2O2 — CID 120886600
N-(2-aminoethyl)-2-(3,4-difluorophenoxy)-N-(2-phenylethyl)propanamide (PubChem CID 120886600) has the molecular formula C19H22F2N2O2 and a molecular weight of 348.39 g/mol. Its IUPAC name is N-(2-aminoethyl)-2-(3,4-difluorophenoxy)-N-(2-phenylethyl)propanamide.
| Compound Name | N-(2-aminoethyl)-2-(3,4-difluorophenoxy)-N-(2-phenylethyl)propanamide |
|---|---|
| PubChem CID | 120886600 |
| Molecular Formula | C19H22F2N2O2 |
| Molecular Weight | 348.39 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | N-(2-aminoethyl)-2-(3,4-difluorophenoxy)-N-(2-phenylethyl)propanamide |
| SMILES | CC(Oc1ccc(F)c(F)c1)C(=O)N(CCN)CCc1ccccc1 |
| InChI | InChI=1S/C19H22F2N2O2/c1-14(25-16-7-8-17(20)18(21)13-16)19(24)23(12-10-22)11-9-15-5-3-2-4-6-15/h2-8,13-14H,9-12,22H2,1H3 |
| InChIKey | OFFMFDDBRCLLNU-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.39 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |