C19H23FN2O3 — CID 120888903
5-(2-fluorophenyl)-N-[[4-(methoxymethyl)piperidin-4-yl]methyl]furan-2-carboxamide (PubChem CID 120888903) has the molecular formula C19H23FN2O3 and a molecular weight of 346.40 g/mol. Its IUPAC name is 5-(2-fluorophenyl)-N-[[4-(methoxymethyl)piperidin-4-yl]methyl]furan-2-carboxamide.
| Compound Name | 5-(2-fluorophenyl)-N-[[4-(methoxymethyl)piperidin-4-yl]methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 120888903 |
| Molecular Formula | C19H23FN2O3 |
| Molecular Weight | 346.40 g/mol |
| Exact Mass | 346.17 |
| IUPAC Name | 5-(2-fluorophenyl)-N-[[4-(methoxymethyl)piperidin-4-yl]methyl]furan-2-carboxamide |
| SMILES | COCC1(CNC(=O)c2ccc(-c3ccccc3F)o2)CCNCC1 |
| InChI | InChI=1S/C19H23FN2O3/c1-24-13-19(8-10-21-11-9-19)12-22-18(23)17-7-6-16(25-17)14-4-2-3-5-15(14)20/h2-7,21H,8-13H2,1H3,(H,22,23) |
| InChIKey | OPVJMCCRAVLXAV-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 63.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.40 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |